C15H20N4O — CID 835854
1-(4-methoxyphenyl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine (PubChem CID 835854) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine.
| Compound Name | 1-(4-methoxyphenyl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
|---|---|
| PubChem CID | 835854 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
| SMILES | COc1ccc(/C=N/C23CN4CN(CN(C4)C2)C3)cc1 |
| InChI | InChI=1S/C15H20N4O/c1-20-14-4-2-13(3-5-14)6-16-15-7-17-10-18(8-15)12-19(9-15)11-17/h2-6H,7-12H2,1H3/b16-6+ |
| InChIKey | LJCHJHMJGJLJRG-OMCISZLKSA-N |
| XLogP | 0.67 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|