About N-quinolin-8-ylbenzamide
N-quinolin-8-ylbenzamide (PubChem CID 836104) has the molecular formula C16H12N2O
and a molecular weight of 248.28 g/mol. Its IUPAC name is N-quinolin-8-ylbenzamide.
Molecular Properties
| Compound Name | N-quinolin-8-ylbenzamide |
| PubChem CID | 836104 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-quinolin-8-ylbenzamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O/c19-16(13-6-2-1-3-7-13)18-14-10-4-8-12-9-5-11-17-15(12)14/h1-11H,(H,18,19) |
| InChIKey | YGICLPNGPGZANM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-quinolin-8-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-quinolin-8-ylbenzamide?
The IUPAC name of N-quinolin-8-ylbenzamide (CID 836104) is N-quinolin-8-ylbenzamide.
What is the SMILES notation for N-quinolin-8-ylbenzamide?
The canonical SMILES for N-quinolin-8-ylbenzamide is O=C(Nc1cccc2cccnc12)c1ccccc1.
What is the InChIKey of N-quinolin-8-ylbenzamide?
The InChIKey is YGICLPNGPGZANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O/c19-16(13-6-2-1-3-7-13)18-14-10-4-8-12-9-5-11-17-15(12)14/h1-11H,(H,18,19).
What are the key properties of N-quinolin-8-ylbenzamide?
N-quinolin-8-ylbenzamide has a molecular weight of 248.28 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-quinolin-8-ylbenzamide is sourced from PubChem (CID 836104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).