C18H15NO2S — CID 83612
Benzenesulfonamide, N-4-biphenylyl- (PubChem CID 83612) has the molecular formula C18H15NO2S and a molecular weight of 309.40 g/mol. Its IUPAC name is N-(4-phenylphenyl)benzenesulfonamide.
| Compound Name | Benzenesulfonamide, N-4-biphenylyl- |
|---|---|
| PubChem CID | 83612 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(4-phenylphenyl)benzenesulfonamide |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NS(=O)(=O)C3=CC=CC=C3 |
| InChI | InChI=1S/C18H15NO2S/c20-22(21,18-9-5-2-6-10-18)19-17-13-11-16(12-14-17)15-7-3-1-4-8-15/h1-14,19H |
| InChIKey | JMNQYDKGYHLAMY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 422 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |