About N-(2-aminoethyl)-1,3-thiazole-5-carboxamide
N-(2-aminoethyl)-1,3-thiazole-5-carboxamide (PubChem CID 83617604) has the molecular formula C6H9N3OS
and a molecular weight of 171.23 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 83617604 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.23 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N-(2-aminoethyl)-1,3-thiazole-5-carboxamide |
| SMILES | NCCNC(=O)c1cncs1 |
| InChI | InChI=1S/C6H9N3OS/c7-1-2-9-6(10)5-3-8-4-11-5/h3-4H,1-2,7H2,(H,9,10) |
| InChIKey | IIOVGOAURVRYOW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminoethyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(2-aminoethyl)-1,3-thiazole-5-carboxamide (CID 83617604) is N-(2-aminoethyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-1,3-thiazole-5-carboxamide is NCCNC(=O)c1cncs1.
What is the InChIKey of N-(2-aminoethyl)-1,3-thiazole-5-carboxamide?
The InChIKey is IIOVGOAURVRYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c7-1-2-9-6(10)5-3-8-4-11-5/h3-4H,1-2,7H2,(H,9,10).
What are the key properties of N-(2-aminoethyl)-1,3-thiazole-5-carboxamide?
N-(2-aminoethyl)-1,3-thiazole-5-carboxamide has a molecular weight of 171.23 g/mol, XLogP of -0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 83617604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).