About N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide
N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide (PubChem CID 83617638) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide |
| PubChem CID | 83617638 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)NCC(C)N)co1 |
| InChI | InChI=1S/C9H15N3O2/c1-6(10)4-11-9(13)3-8-5-14-7(2)12-8/h5-6H,3-4,10H2,1-2H3,(H,11,13) |
| InChIKey | IFIHIIILHXWBLW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide?
The IUPAC name of N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide (CID 83617638) is N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide.
What is the SMILES notation for N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide?
The canonical SMILES for N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide is Cc1nc(CC(=O)NCC(C)N)co1.
What is the InChIKey of N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide?
The InChIKey is IFIHIIILHXWBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-6(10)4-11-9(13)3-8-5-14-7(2)12-8/h5-6H,3-4,10H2,1-2H3,(H,11,13).
What are the key properties of N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide?
N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide has a molecular weight of 197.24 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminopropyl)-2-(2-methyl-1,3-oxazol-4-yl)acetamide is sourced from PubChem (CID 83617638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).