2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid

C7H8N2O4 — CID 83617811

IUPAC2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1cnoc1
InChIInChI=1S/C7H8N2O4/c1-9(3-6(10)11)7(12)5-2-8-13-4-5/h2,4H,3H2,1H3,(H,10,11)
InChIKeySLVPXBHQQWIFGE-UHFFFAOYSA-N
MW184.15 g/mol
LogP-0.17
Rot. Bonds3

About 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid

2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid (PubChem CID 83617811) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid
PubChem CID83617811
Molecular FormulaC7H8N2O4
Molecular Weight184.15 g/mol
Exact Mass184.05
IUPAC Name2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1cnoc1
InChIInChI=1S/C7H8N2O4/c1-9(3-6(10)11)7(12)5-2-8-13-4-5/h2,4H,3H2,1H3,(H,10,11)
InChIKeySLVPXBHQQWIFGE-UHFFFAOYSA-N
XLogP-0.17
TPSA83.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 5-0.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid?
The IUPAC name of 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid (CID 83617811) is 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid is CN(CC(=O)O)C(=O)c1cnoc1.
What is the InChIKey of 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid?
The InChIKey is SLVPXBHQQWIFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-9(3-6(10)11)7(12)5-2-8-13-4-5/h2,4H,3H2,1H3,(H,10,11).
What are the key properties of 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid?
2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid has a molecular weight of 184.15 g/mol, XLogP of -0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,2-oxazole-4-carbonyl)amino]acetic acid is sourced from PubChem (CID 83617811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).