About 8-ethyl-1,8-diazaspiro[5.5]undecane
8-ethyl-1,8-diazaspiro[5.5]undecane (PubChem CID 83618601) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 8-ethyl-1,8-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 8-ethyl-1,8-diazaspiro[5.5]undecane |
| PubChem CID | 83618601 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 8-ethyl-1,8-diazaspiro[5.5]undecane |
| SMILES | CCN1CCCC2(CCCCN2)C1 |
| InChI | InChI=1S/C11H22N2/c1-2-13-9-5-7-11(10-13)6-3-4-8-12-11/h12H,2-10H2,1H3 |
| InChIKey | CBYJBDYHVRIBSQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-1,8-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-1,8-diazaspiro[5.5]undecane?
The IUPAC name of 8-ethyl-1,8-diazaspiro[5.5]undecane (CID 83618601) is 8-ethyl-1,8-diazaspiro[5.5]undecane.
What is the SMILES notation for 8-ethyl-1,8-diazaspiro[5.5]undecane?
The canonical SMILES for 8-ethyl-1,8-diazaspiro[5.5]undecane is CCN1CCCC2(CCCCN2)C1.
What is the InChIKey of 8-ethyl-1,8-diazaspiro[5.5]undecane?
The InChIKey is CBYJBDYHVRIBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-2-13-9-5-7-11(10-13)6-3-4-8-12-11/h12H,2-10H2,1H3.
What are the key properties of 8-ethyl-1,8-diazaspiro[5.5]undecane?
8-ethyl-1,8-diazaspiro[5.5]undecane has a molecular weight of 182.31 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-1,8-diazaspiro[5.5]undecane is sourced from PubChem (CID 83618601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).