About 6-propan-2-yl-2,6-diazaspiro[4.5]decane
6-propan-2-yl-2,6-diazaspiro[4.5]decane (PubChem CID 83618639) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 6-propan-2-yl-2,6-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-propan-2-yl-2,6-diazaspiro[4.5]decane |
| PubChem CID | 83618639 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 6-propan-2-yl-2,6-diazaspiro[4.5]decane |
| SMILES | CC(C)N1CCCCC12CCNC2 |
| InChI | InChI=1S/C11H22N2/c1-10(2)13-8-4-3-5-11(13)6-7-12-9-11/h10,12H,3-9H2,1-2H3 |
| InChIKey | IVOWYHAGEUKCDM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-propan-2-yl-2,6-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-2,6-diazaspiro[4.5]decane?
The IUPAC name of 6-propan-2-yl-2,6-diazaspiro[4.5]decane (CID 83618639) is 6-propan-2-yl-2,6-diazaspiro[4.5]decane.
What is the SMILES notation for 6-propan-2-yl-2,6-diazaspiro[4.5]decane?
The canonical SMILES for 6-propan-2-yl-2,6-diazaspiro[4.5]decane is CC(C)N1CCCCC12CCNC2.
What is the InChIKey of 6-propan-2-yl-2,6-diazaspiro[4.5]decane?
The InChIKey is IVOWYHAGEUKCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-10(2)13-8-4-3-5-11(13)6-7-12-9-11/h10,12H,3-9H2,1-2H3.
What are the key properties of 6-propan-2-yl-2,6-diazaspiro[4.5]decane?
6-propan-2-yl-2,6-diazaspiro[4.5]decane has a molecular weight of 182.31 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-2,6-diazaspiro[4.5]decane is sourced from PubChem (CID 83618639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).