C8H11N3O2 — CID 83618694
5-pyrrolidin-1-yl-1H-pyrazole-4-carboxylic acid (PubChem CID 83618694) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 5-pyrrolidin-1-yl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-pyrrolidin-1-yl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 83618694 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-pyrrolidin-1-yl-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1N1CCCC1 |
| InChI | InChI=1S/C8H11N3O2/c12-8(13)6-5-9-10-7(6)11-3-1-2-4-11/h5H,1-4H2,(H,9,10)(H,12,13) |
| InChIKey | FYDQVWZKWRSEJN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |