C9H16N4O — CID 83618709
[3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 83618709) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is [3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 83618709 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | NCc1nc(N2CCCCCC2)no1 |
| InChI | InChI=1S/C9H16N4O/c10-7-8-11-9(12-14-8)13-5-3-1-2-4-6-13/h1-7,10H2 |
| InChIKey | JYQFSHVPAMPMKV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |