About 4-N-thiophen-2-ylpyrimidine-4,5-diamine
4-N-thiophen-2-ylpyrimidine-4,5-diamine (PubChem CID 83618912) has the molecular formula C8H8N4S
and a molecular weight of 192.25 g/mol. Its IUPAC name is 4-N-thiophen-2-ylpyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 4-N-thiophen-2-ylpyrimidine-4,5-diamine |
| PubChem CID | 83618912 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-N-thiophen-2-ylpyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1Nc1cccs1 |
| InChI | InChI=1S/C8H8N4S/c9-6-4-10-5-11-8(6)12-7-2-1-3-13-7/h1-5H,9H2,(H,10,11,12) |
| InChIKey | RTHWIGJEOZXJJW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-thiophen-2-ylpyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-thiophen-2-ylpyrimidine-4,5-diamine?
The IUPAC name of 4-N-thiophen-2-ylpyrimidine-4,5-diamine (CID 83618912) is 4-N-thiophen-2-ylpyrimidine-4,5-diamine.
What is the SMILES notation for 4-N-thiophen-2-ylpyrimidine-4,5-diamine?
The canonical SMILES for 4-N-thiophen-2-ylpyrimidine-4,5-diamine is Nc1cncnc1Nc1cccs1.
What is the InChIKey of 4-N-thiophen-2-ylpyrimidine-4,5-diamine?
The InChIKey is RTHWIGJEOZXJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S/c9-6-4-10-5-11-8(6)12-7-2-1-3-13-7/h1-5H,9H2,(H,10,11,12).
What are the key properties of 4-N-thiophen-2-ylpyrimidine-4,5-diamine?
4-N-thiophen-2-ylpyrimidine-4,5-diamine has a molecular weight of 192.25 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-thiophen-2-ylpyrimidine-4,5-diamine is sourced from PubChem (CID 83618912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).