About 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid
2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid (PubChem CID 83619941) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid.
Molecular Properties
| Compound Name | 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid |
| PubChem CID | 83619941 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid |
| SMILES | Cc1ncnc(NC(C)C(=O)O)c1C |
| InChI | InChI=1S/C9H13N3O2/c1-5-6(2)10-4-11-8(5)12-7(3)9(13)14/h4,7H,1-3H3,(H,13,14)(H,10,11,12) |
| InChIKey | KASZNBNLPGKANZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid?
The IUPAC name of 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid (CID 83619941) is 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid.
What is the SMILES notation for 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid?
The canonical SMILES for 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid is Cc1ncnc(NC(C)C(=O)O)c1C.
What is the InChIKey of 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid?
The InChIKey is KASZNBNLPGKANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-5-6(2)10-4-11-8(5)12-7(3)9(13)14/h4,7H,1-3H3,(H,13,14)(H,10,11,12).
What are the key properties of 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid?
2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid has a molecular weight of 195.22 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethylpyrimidin-4-yl)amino]propanoic acid is sourced from PubChem (CID 83619941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).