C11H18N2O — CID 83637307
2-(oxan-4-yl)-2-(1H-pyrrol-3-yl)ethanamine (PubChem CID 83637307) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(oxan-4-yl)-2-(1H-pyrrol-3-yl)ethanamine.
| Compound Name | 2-(oxan-4-yl)-2-(1H-pyrrol-3-yl)ethanamine |
|---|---|
| PubChem CID | 83637307 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(oxan-4-yl)-2-(1H-pyrrol-3-yl)ethanamine |
| SMILES | NCC(c1cc[nH]c1)C1CCOCC1 |
| InChI | InChI=1S/C11H18N2O/c12-7-11(10-1-4-13-8-10)9-2-5-14-6-3-9/h1,4,8-9,11,13H,2-3,5-7,12H2 |
| InChIKey | FGNBQMITOXTZJU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |