7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid

C10H10FNO2 — CID 83637335

IUPAC7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
SMILESO=C(O)C1CCNc2cc(F)ccc21
InChIInChI=1S/C10H10FNO2/c11-6-1-2-7-8(10(13)14)3-4-12-9(7)5-6/h1-2,5,8,12H,3-4H2,(H,13,14)
InChIKeyRLCHXHGIHXSTID-UHFFFAOYSA-N
MW195.19 g/mol
LogP1.81
Rot. Bonds1

About 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid

7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (PubChem CID 83637335) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid.

Molecular Properties

Compound Name7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
PubChem CID83637335
Molecular FormulaC10H10FNO2
Molecular Weight195.19 g/mol
Exact Mass195.07
IUPAC Name7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
SMILESO=C(O)C1CCNc2cc(F)ccc21
InChIInChI=1S/C10H10FNO2/c11-6-1-2-7-8(10(13)14)3-4-12-9(7)5-6/h1-2,5,8,12H,3-4H2,(H,13,14)
InChIKeyRLCHXHGIHXSTID-UHFFFAOYSA-N
XLogP1.81
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.19
LogP ≤ 51.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The IUPAC name of 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CID 83637335) is 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid.
What is the SMILES notation for 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The canonical SMILES for 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid is O=C(O)C1CCNc2cc(F)ccc21.
What is the InChIKey of 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The InChIKey is RLCHXHGIHXSTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2/c11-6-1-2-7-8(10(13)14)3-4-12-9(7)5-6/h1-2,5,8,12H,3-4H2,(H,13,14).
What are the key properties of 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid has a molecular weight of 195.19 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid is sourced from PubChem (CID 83637335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).