C10H10FNO2 — CID 83637335
7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (PubChem CID 83637335) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid.
| Compound Name | 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 83637335 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| SMILES | O=C(O)C1CCNc2cc(F)ccc21 |
| InChI | InChI=1S/C10H10FNO2/c11-6-1-2-7-8(10(13)14)3-4-12-9(7)5-6/h1-2,5,8,12H,3-4H2,(H,13,14) |
| InChIKey | RLCHXHGIHXSTID-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |