About 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine
2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine (PubChem CID 83639560) has the molecular formula C11H9N5
and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 83639560 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine |
| SMILES | Nc1ccc2nc(-c3ccncc3)cn2n1 |
| InChI | InChI=1S/C11H9N5/c12-10-1-2-11-14-9(7-16(11)15-10)8-3-5-13-6-4-8/h1-7H,(H2,12,15) |
| InChIKey | NBQVYJXGMQWBJZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine (CID 83639560) is 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine is Nc1ccc2nc(-c3ccncc3)cn2n1.
What is the InChIKey of 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine?
The InChIKey is NBQVYJXGMQWBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5/c12-10-1-2-11-14-9(7-16(11)15-10)8-3-5-13-6-4-8/h1-7H,(H2,12,15).
What are the key properties of 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine?
2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine has a molecular weight of 211.23 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 83639560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).