C11H13N3O3S — CID 83662420
5-(2,4,6-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 83662420) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 5-(2,4,6-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2,4,6-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 83662420 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-(2,4,6-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cc(OC)c(-c2nnc(N)s2)c(OC)c1 |
| InChI | InChI=1S/C11H13N3O3S/c1-15-6-4-7(16-2)9(8(5-6)17-3)10-13-14-11(12)18-10/h4-5H,1-3H3,(H2,12,14) |
| InChIKey | MGVWNNZQOMPJPP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |