C17H23N3 — CID 83663596
3-methyl-1-(2,3,5,6-tetramethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine (PubChem CID 83663596) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-methyl-1-(2,3,5,6-tetramethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
| Compound Name | 3-methyl-1-(2,3,5,6-tetramethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 83663596 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 3-methyl-1-(2,3,5,6-tetramethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine |
| SMILES | Cc1cc(C)c(C)c(-c2nc(C)n3c2CNCC3)c1C |
| InChI | InChI=1S/C17H23N3/c1-10-8-11(2)13(4)16(12(10)3)17-15-9-18-6-7-20(15)14(5)19-17/h8,18H,6-7,9H2,1-5H3 |
| InChIKey | HIPGPDWEUWBWCQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |