C8H9N3S — CID 83667987
5,6-dimethyl-[1,3]thiazolo[4,5-b]pyridin-2-amine (PubChem CID 83667987) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 5,6-dimethyl-[1,3]thiazolo[4,5-b]pyridin-2-amine.
| Compound Name | 5,6-dimethyl-[1,3]thiazolo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 83667987 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5,6-dimethyl-[1,3]thiazolo[4,5-b]pyridin-2-amine |
| SMILES | Cc1cc2sc(N)nc2nc1C |
| InChI | InChI=1S/C8H9N3S/c1-4-3-6-7(10-5(4)2)11-8(9)12-6/h3H,1-2H3,(H2,9,10,11) |
| InChIKey | FHHCGWQAIQFIEK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |