C9H12N2O — CID 83668111
1,5,6,7,8,9-hexahydropyrido[2,3-c]azepin-2-one (PubChem CID 83668111) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,5,6,7,8,9-hexahydropyrido[2,3-c]azepin-2-one.
| Compound Name | 1,5,6,7,8,9-hexahydropyrido[2,3-c]azepin-2-one |
|---|---|
| PubChem CID | 83668111 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,5,6,7,8,9-hexahydropyrido[2,3-c]azepin-2-one |
| SMILES | O=c1ccc2c([nH]1)CNCCC2 |
| InChI | InChI=1S/C9H12N2O/c12-9-4-3-7-2-1-5-10-6-8(7)11-9/h3-4,10H,1-2,5-6H2,(H,11,12) |
| InChIKey | DTVFLFRXICELEJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |