About 3-methoxy-1,2-benzoxazol-5-amine
3-methoxy-1,2-benzoxazol-5-amine (PubChem CID 83668440) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 3-methoxy-1,2-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 3-methoxy-1,2-benzoxazol-5-amine |
| PubChem CID | 83668440 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 3-methoxy-1,2-benzoxazol-5-amine |
| SMILES | COc1noc2ccc(N)cc12 |
| InChI | InChI=1S/C8H8N2O2/c1-11-8-6-4-5(9)2-3-7(6)12-10-8/h2-4H,9H2,1H3 |
| InChIKey | VPDMTEHAEFEQMK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-1,2-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1,2-benzoxazol-5-amine?
The IUPAC name of 3-methoxy-1,2-benzoxazol-5-amine (CID 83668440) is 3-methoxy-1,2-benzoxazol-5-amine.
What is the SMILES notation for 3-methoxy-1,2-benzoxazol-5-amine?
The canonical SMILES for 3-methoxy-1,2-benzoxazol-5-amine is COc1noc2ccc(N)cc12.
What is the InChIKey of 3-methoxy-1,2-benzoxazol-5-amine?
The InChIKey is VPDMTEHAEFEQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c1-11-8-6-4-5(9)2-3-7(6)12-10-8/h2-4H,9H2,1H3.
What are the key properties of 3-methoxy-1,2-benzoxazol-5-amine?
3-methoxy-1,2-benzoxazol-5-amine has a molecular weight of 164.16 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1,2-benzoxazol-5-amine is sourced from PubChem (CID 83668440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).