C8H15NO — CID 83669058
3,3a,4,5,6,7,8,8a-octahydro-1H-furo[3,4-d]azepine (PubChem CID 83669058) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 3,3a,4,5,6,7,8,8a-octahydro-1H-furo[3,4-d]azepine.
| Compound Name | 3,3a,4,5,6,7,8,8a-octahydro-1H-furo[3,4-d]azepine |
|---|---|
| PubChem CID | 83669058 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 3,3a,4,5,6,7,8,8a-octahydro-1H-furo[3,4-d]azepine |
| SMILES | C1CC2COCC2CCN1 |
| InChI | InChI=1S/C8H15NO/c1-3-9-4-2-8-6-10-5-7(1)8/h7-9H,1-6H2 |
| InChIKey | JBCCWOYWHGRDNQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |