About 7-bromo-1,2-benzoxazol-5-ol
7-bromo-1,2-benzoxazol-5-ol (PubChem CID 83669491) has the molecular formula C7H4BrNO2
and a molecular weight of 214.02 g/mol. Its IUPAC name is 7-bromo-1,2-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 7-bromo-1,2-benzoxazol-5-ol |
| PubChem CID | 83669491 |
| Molecular Formula | C7H4BrNO2 |
| Molecular Weight | 214.02 g/mol |
| Exact Mass | 212.94 |
| IUPAC Name | 7-bromo-1,2-benzoxazol-5-ol |
| SMILES | Oc1cc(Br)c2oncc2c1 |
| InChI | InChI=1S/C7H4BrNO2/c8-6-2-5(10)1-4-3-9-11-7(4)6/h1-3,10H |
| InChIKey | DEYDZGZTDGOPEF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.02 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-1,2-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1,2-benzoxazol-5-ol?
The IUPAC name of 7-bromo-1,2-benzoxazol-5-ol (CID 83669491) is 7-bromo-1,2-benzoxazol-5-ol.
What is the SMILES notation for 7-bromo-1,2-benzoxazol-5-ol?
The canonical SMILES for 7-bromo-1,2-benzoxazol-5-ol is Oc1cc(Br)c2oncc2c1.
What is the InChIKey of 7-bromo-1,2-benzoxazol-5-ol?
The InChIKey is DEYDZGZTDGOPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNO2/c8-6-2-5(10)1-4-3-9-11-7(4)6/h1-3,10H.
What are the key properties of 7-bromo-1,2-benzoxazol-5-ol?
7-bromo-1,2-benzoxazol-5-ol has a molecular weight of 214.02 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1,2-benzoxazol-5-ol is sourced from PubChem (CID 83669491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).