C6H3Cl2N3O — CID 83669847
2,4-dichloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 83669847) has the molecular formula C6H3Cl2N3O and a molecular weight of 204.02 g/mol. Its IUPAC name is 2,4-dichloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2,4-dichloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 83669847 |
| Molecular Formula | C6H3Cl2N3O |
| Molecular Weight | 204.02 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | 2,4-dichloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Cc2c(Cl)nc(Cl)nc2N1 |
| InChI | InChI=1S/C6H3Cl2N3O/c7-4-2-1-3(12)9-5(2)11-6(8)10-4/h1H2,(H,9,10,11,12) |
| InChIKey | IGMUFDAQGZNNIM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.02 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |