C13H24N2O3 — CID 83670214
tert-butyl 9-oxa-2,6-diazaspiro[4.6]undecane-6-carboxylate (PubChem CID 83670214) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl 9-oxa-2,6-diazaspiro[4.6]undecane-6-carboxylate.
| Compound Name | tert-butyl 9-oxa-2,6-diazaspiro[4.6]undecane-6-carboxylate |
|---|---|
| PubChem CID | 83670214 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl 9-oxa-2,6-diazaspiro[4.6]undecane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCCC12CCNC2 |
| InChI | InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-7-9-17-8-5-13(15)4-6-14-10-13/h14H,4-10H2,1-3H3 |
| InChIKey | UWGGVCLWQYPDDR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |