About 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 83672234) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
Analyze 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
The IUPAC name of 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (CID 83672234) is 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
The canonical SMILES for 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is CC1CNCc2cccn21.
What is the InChIKey of 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
The InChIKey is LCONNNJMUCBRSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-7-5-9-6-8-3-2-4-10(7)8/h2-4,7,9H,5-6H2,1H3.
What are the key properties of 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine has a molecular weight of 136.20 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 83672234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).