About thiane-4-carboximidamide
thiane-4-carboximidamide (PubChem CID 83677490) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is thiane-4-carboximidamide.
Molecular Properties
| Compound Name | thiane-4-carboximidamide |
| PubChem CID | 83677490 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | thiane-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCSCC1 |
| InChI | InChI=1S/C6H12N2S/c7-6(8)5-1-3-9-4-2-5/h5H,1-4H2,(H3,7,8) |
| InChIKey | PXIPUUCWGORUNN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze thiane-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiane-4-carboximidamide?
The IUPAC name of thiane-4-carboximidamide (CID 83677490) is thiane-4-carboximidamide.
What is the SMILES notation for thiane-4-carboximidamide?
The canonical SMILES for thiane-4-carboximidamide is [H]/N=C(\N)C1CCSCC1.
What is the InChIKey of thiane-4-carboximidamide?
The InChIKey is PXIPUUCWGORUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c7-6(8)5-1-3-9-4-2-5/h5H,1-4H2,(H3,7,8).
What are the key properties of thiane-4-carboximidamide?
thiane-4-carboximidamide has a molecular weight of 144.24 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiane-4-carboximidamide is sourced from PubChem (CID 83677490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).