About 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid
5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid (PubChem CID 83679237) has the molecular formula C7H6BrNO2S
and a molecular weight of 248.10 g/mol. Its IUPAC name is 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid |
| PubChem CID | 83679237 |
| Molecular Formula | C7H6BrNO2S |
| Molecular Weight | 248.10 g/mol |
| Exact Mass | 246.93 |
| IUPAC Name | 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(C2CC2)c(Br)s1 |
| InChI | InChI=1S/C7H6BrNO2S/c8-5-4(3-1-2-3)9-6(12-5)7(10)11/h3H,1-2H2,(H,10,11) |
| InChIKey | GIZQRVUBWWLQHC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.10 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid (CID 83679237) is 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid is O=C(O)c1nc(C2CC2)c(Br)s1.
What is the InChIKey of 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
The InChIKey is GIZQRVUBWWLQHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO2S/c8-5-4(3-1-2-3)9-6(12-5)7(10)11/h3H,1-2H2,(H,10,11).
What are the key properties of 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid has a molecular weight of 248.10 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-cyclopropyl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 83679237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).