C8H10BrNO — CID 83679561
2-bromo-5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine (PubChem CID 83679561) has the molecular formula C8H10BrNO and a molecular weight of 216.08 g/mol. Its IUPAC name is 2-bromo-5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine.
| Compound Name | 2-bromo-5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine |
|---|---|
| PubChem CID | 83679561 |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 2-bromo-5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine |
| SMILES | Brc1cc2c(o1)CCCNC2 |
| InChI | InChI=1S/C8H10BrNO/c9-8-4-6-5-10-3-1-2-7(6)11-8/h4,10H,1-3,5H2 |
| InChIKey | OZFQEKNJQJEZKK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |