About 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine
2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine (PubChem CID 83679999) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine.
Molecular Properties
| Compound Name | 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine |
| PubChem CID | 83679999 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine |
| SMILES | Cn1nc2c(c1N)COC2 |
| InChI | InChI=1S/C6H9N3O/c1-9-6(7)4-2-10-3-5(4)8-9/h2-3,7H2,1H3 |
| InChIKey | CNXLMXMPLLVBRM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine?
The IUPAC name of 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine (CID 83679999) is 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine.
What is the SMILES notation for 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine?
The canonical SMILES for 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine is Cn1nc2c(c1N)COC2.
What is the InChIKey of 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine?
The InChIKey is CNXLMXMPLLVBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-9-6(7)4-2-10-3-5(4)8-9/h2-3,7H2,1H3.
What are the key properties of 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine?
2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine has a molecular weight of 139.16 g/mol, XLogP of 0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,6-dihydrofuro[3,4-c]pyrazol-3-amine is sourced from PubChem (CID 83679999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).