C10H19N — CID 83680079
7a-ethyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine (PubChem CID 83680079) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 7a-ethyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine.
| Compound Name | 7a-ethyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 83680079 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 7a-ethyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine |
| SMILES | CCC12CCCC1CCCN2 |
| InChI | InChI=1S/C10H19N/c1-2-10-7-3-5-9(10)6-4-8-11-10/h9,11H,2-8H2,1H3 |
| InChIKey | VEMRVTWLJOCRSL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |