About 7-bromothieno[3,2-c]pyridine
7-bromothieno[3,2-c]pyridine (PubChem CID 83680878) has the molecular formula C7H4BrNS
and a molecular weight of 214.09 g/mol. Its IUPAC name is 7-bromothieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 7-bromothieno[3,2-c]pyridine |
| PubChem CID | 83680878 |
| Molecular Formula | C7H4BrNS |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 212.92 |
| IUPAC Name | 7-bromothieno[3,2-c]pyridine |
| SMILES | Brc1cncc2ccsc12 |
| InChI | InChI=1S/C7H4BrNS/c8-6-4-9-3-5-1-2-10-7(5)6/h1-4H |
| InChIKey | RZFQVVYYJKTTCN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromothieno[3,2-c]pyridine?
The IUPAC name of 7-bromothieno[3,2-c]pyridine (CID 83680878) is 7-bromothieno[3,2-c]pyridine.
What is the SMILES notation for 7-bromothieno[3,2-c]pyridine?
The canonical SMILES for 7-bromothieno[3,2-c]pyridine is Brc1cncc2ccsc12.
What is the InChIKey of 7-bromothieno[3,2-c]pyridine?
The InChIKey is RZFQVVYYJKTTCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNS/c8-6-4-9-3-5-1-2-10-7(5)6/h1-4H.
What are the key properties of 7-bromothieno[3,2-c]pyridine?
7-bromothieno[3,2-c]pyridine has a molecular weight of 214.09 g/mol, XLogP of 3.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromothieno[3,2-c]pyridine is sourced from PubChem (CID 83680878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).