About 7-methylimidazo[1,5-a]pyrazin-8-one
7-methylimidazo[1,5-a]pyrazin-8-one (PubChem CID 83681137) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 7-methylimidazo[1,5-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 7-methylimidazo[1,5-a]pyrazin-8-one |
| PubChem CID | 83681137 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 7-methylimidazo[1,5-a]pyrazin-8-one |
| SMILES | Cn1ccn2cncc2c1=O |
| InChI | InChI=1S/C7H7N3O/c1-9-2-3-10-5-8-4-6(10)7(9)11/h2-5H,1H3 |
| InChIKey | XJEKXPMEQJXWRP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methylimidazo[1,5-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylimidazo[1,5-a]pyrazin-8-one?
The IUPAC name of 7-methylimidazo[1,5-a]pyrazin-8-one (CID 83681137) is 7-methylimidazo[1,5-a]pyrazin-8-one.
What is the SMILES notation for 7-methylimidazo[1,5-a]pyrazin-8-one?
The canonical SMILES for 7-methylimidazo[1,5-a]pyrazin-8-one is Cn1ccn2cncc2c1=O.
What is the InChIKey of 7-methylimidazo[1,5-a]pyrazin-8-one?
The InChIKey is XJEKXPMEQJXWRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-9-2-3-10-5-8-4-6(10)7(9)11/h2-5H,1H3.
What are the key properties of 7-methylimidazo[1,5-a]pyrazin-8-one?
7-methylimidazo[1,5-a]pyrazin-8-one has a molecular weight of 149.15 g/mol, XLogP of 0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylimidazo[1,5-a]pyrazin-8-one is sourced from PubChem (CID 83681137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).