About 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid
3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid (PubChem CID 83681168) has the molecular formula C6H3BrN2O2S
and a molecular weight of 247.07 g/mol. Its IUPAC name is 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid |
| PubChem CID | 83681168 |
| Molecular Formula | C6H3BrN2O2S |
| Molecular Weight | 247.07 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2n[nH]c(Br)c2s1 |
| InChI | InChI=1S/C6H3BrN2O2S/c7-5-4-2(8-9-5)1-3(12-4)6(10)11/h1H,(H,8,9)(H,10,11) |
| InChIKey | GKIOJSKJOJEASB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid?
The IUPAC name of 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid (CID 83681168) is 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid?
The canonical SMILES for 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid is O=C(O)c1cc2n[nH]c(Br)c2s1.
What is the InChIKey of 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid?
The InChIKey is GKIOJSKJOJEASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN2O2S/c7-5-4-2(8-9-5)1-3(12-4)6(10)11/h1H,(H,8,9)(H,10,11).
What are the key properties of 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid?
3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid has a molecular weight of 247.07 g/mol, XLogP of 2.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylic acid is sourced from PubChem (CID 83681168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).