About 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid
3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid (PubChem CID 83681169) has the molecular formula C6H5N3O2S
and a molecular weight of 183.19 g/mol. Its IUPAC name is 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid |
| PubChem CID | 83681169 |
| Molecular Formula | C6H5N3O2S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid |
| SMILES | Nc1n[nH]c2cc(C(=O)O)sc12 |
| InChI | InChI=1S/C6H5N3O2S/c7-5-4-2(8-9-5)1-3(12-4)6(10)11/h1H,(H,10,11)(H3,7,8,9) |
| InChIKey | DUZOZCCLEDGCCM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid?
The IUPAC name of 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid (CID 83681169) is 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid?
The canonical SMILES for 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid is Nc1n[nH]c2cc(C(=O)O)sc12.
What is the InChIKey of 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid?
The InChIKey is DUZOZCCLEDGCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2S/c7-5-4-2(8-9-5)1-3(12-4)6(10)11/h1H,(H,10,11)(H3,7,8,9).
What are the key properties of 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid?
3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid has a molecular weight of 183.19 g/mol, XLogP of 0.90, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylic acid is sourced from PubChem (CID 83681169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).