About 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine
7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 83681276) has the molecular formula C5H6N6
and a molecular weight of 150.14 g/mol. Its IUPAC name is 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine |
| PubChem CID | 83681276 |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | Cc1nc(N)nc2n[nH]nc12 |
| InChI | InChI=1S/C5H6N6/c1-2-3-4(10-11-9-3)8-5(6)7-2/h1H3,(H3,6,7,8,9,10,11) |
| InChIKey | PPWVAABVTHYCGO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine?
The IUPAC name of 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine (CID 83681276) is 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine.
What is the SMILES notation for 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine?
The canonical SMILES for 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine is Cc1nc(N)nc2n[nH]nc12.
What is the InChIKey of 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine?
The InChIKey is PPWVAABVTHYCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N6/c1-2-3-4(10-11-9-3)8-5(6)7-2/h1H3,(H3,6,7,8,9,10,11).
What are the key properties of 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine?
7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine has a molecular weight of 150.14 g/mol, XLogP of -0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2H-triazolo[4,5-d]pyrimidin-5-amine is sourced from PubChem (CID 83681276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).