About 4-bromo-2H-triazolo[4,5-c]pyridine
4-bromo-2H-triazolo[4,5-c]pyridine (PubChem CID 83681327) has the molecular formula C5H3BrN4
and a molecular weight of 199.01 g/mol. Its IUPAC name is 4-bromo-2H-triazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 4-bromo-2H-triazolo[4,5-c]pyridine |
| PubChem CID | 83681327 |
| Molecular Formula | C5H3BrN4 |
| Molecular Weight | 199.01 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | 4-bromo-2H-triazolo[4,5-c]pyridine |
| SMILES | Brc1nccc2n[nH]nc12 |
| InChI | InChI=1S/C5H3BrN4/c6-5-4-3(1-2-7-5)8-10-9-4/h1-2H,(H,8,9,10) |
| InChIKey | JTBULDQWNXQQCY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.01 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2H-triazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2H-triazolo[4,5-c]pyridine?
The IUPAC name of 4-bromo-2H-triazolo[4,5-c]pyridine (CID 83681327) is 4-bromo-2H-triazolo[4,5-c]pyridine.
What is the SMILES notation for 4-bromo-2H-triazolo[4,5-c]pyridine?
The canonical SMILES for 4-bromo-2H-triazolo[4,5-c]pyridine is Brc1nccc2n[nH]nc12.
What is the InChIKey of 4-bromo-2H-triazolo[4,5-c]pyridine?
The InChIKey is JTBULDQWNXQQCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrN4/c6-5-4-3(1-2-7-5)8-10-9-4/h1-2H,(H,8,9,10).
What are the key properties of 4-bromo-2H-triazolo[4,5-c]pyridine?
4-bromo-2H-triazolo[4,5-c]pyridine has a molecular weight of 199.01 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2H-triazolo[4,5-c]pyridine is sourced from PubChem (CID 83681327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).