About 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one
6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one (PubChem CID 83681515) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one.
Analyze 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one?
The IUPAC name of 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one (CID 83681515) is 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one?
The canonical SMILES for 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one is O=c1ccnc2n1CCNC2.
What is the InChIKey of 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one?
The InChIKey is HEUHUHDDCRGEMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c11-7-1-2-9-6-5-8-3-4-10(6)7/h1-2,8H,3-5H2.
What are the key properties of 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one?
6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one has a molecular weight of 151.17 g/mol, XLogP of -0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 83681515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).