About 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine
3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine (PubChem CID 83681518) has the molecular formula C6H7BrN2O
and a molecular weight of 203.04 g/mol. Its IUPAC name is 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine.
Molecular Properties
| Compound Name | 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine |
| PubChem CID | 83681518 |
| Molecular Formula | C6H7BrN2O |
| Molecular Weight | 203.04 g/mol |
| Exact Mass | 201.97 |
| IUPAC Name | 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine |
| SMILES | Brc1cnc2n1CCOC2 |
| InChI | InChI=1S/C6H7BrN2O/c7-5-3-8-6-4-10-2-1-9(5)6/h3H,1-2,4H2 |
| InChIKey | FGJHAKWQBRSVQY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.04 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine?
The IUPAC name of 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine (CID 83681518) is 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine.
What is the SMILES notation for 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine?
The canonical SMILES for 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine is Brc1cnc2n1CCOC2.
What is the InChIKey of 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine?
The InChIKey is FGJHAKWQBRSVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2O/c7-5-3-8-6-4-10-2-1-9(5)6/h3H,1-2,4H2.
What are the key properties of 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine?
3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine has a molecular weight of 203.04 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine is sourced from PubChem (CID 83681518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).