About 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 83681528) has the molecular formula C7H9BrN2
and a molecular weight of 201.07 g/mol. Its IUPAC name is 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 83681528 |
| Molecular Formula | C7H9BrN2 |
| Molecular Weight | 201.07 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | Cc1nc2n(c1Br)CCC2 |
| InChI | InChI=1S/C7H9BrN2/c1-5-7(8)10-4-2-3-6(10)9-5/h2-4H2,1H3 |
| InChIKey | NWVJWZQAQDUYRE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.07 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 83681528) is 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is Cc1nc2n(c1Br)CCC2.
What is the InChIKey of 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is NWVJWZQAQDUYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2/c1-5-7(8)10-4-2-3-6(10)9-5/h2-4H2,1H3.
What are the key properties of 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 201.07 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 83681528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).