About 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole
2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole (PubChem CID 83682035) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole.
Molecular Properties
| Compound Name | 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole |
| PubChem CID | 83682035 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole |
| SMILES | CCc1nc2c(s1)CNC2 |
| InChI | InChI=1S/C7H10N2S/c1-2-7-9-5-3-8-4-6(5)10-7/h8H,2-4H2,1H3 |
| InChIKey | HGNUYZMVIWTWQV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole?
The IUPAC name of 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole (CID 83682035) is 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole.
What is the SMILES notation for 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole?
The canonical SMILES for 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole is CCc1nc2c(s1)CNC2.
What is the InChIKey of 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole?
The InChIKey is HGNUYZMVIWTWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S/c1-2-7-9-5-3-8-4-6(5)10-7/h8H,2-4H2,1H3.
What are the key properties of 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole?
2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole has a molecular weight of 154.24 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole is sourced from PubChem (CID 83682035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).