About 1-(2,4-dimethylpentyl)cyclopropan-1-amine
1-(2,4-dimethylpentyl)cyclopropan-1-amine (PubChem CID 83682066) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 1-(2,4-dimethylpentyl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(2,4-dimethylpentyl)cyclopropan-1-amine |
| PubChem CID | 83682066 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 1-(2,4-dimethylpentyl)cyclopropan-1-amine |
| SMILES | CC(C)CC(C)CC1(N)CC1 |
| InChI | InChI=1S/C10H21N/c1-8(2)6-9(3)7-10(11)4-5-10/h8-9H,4-7,11H2,1-3H3 |
| InChIKey | NMLSNHBZNGFFOF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,4-dimethylpentyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylpentyl)cyclopropan-1-amine?
The IUPAC name of 1-(2,4-dimethylpentyl)cyclopropan-1-amine (CID 83682066) is 1-(2,4-dimethylpentyl)cyclopropan-1-amine.
What is the SMILES notation for 1-(2,4-dimethylpentyl)cyclopropan-1-amine?
The canonical SMILES for 1-(2,4-dimethylpentyl)cyclopropan-1-amine is CC(C)CC(C)CC1(N)CC1.
What is the InChIKey of 1-(2,4-dimethylpentyl)cyclopropan-1-amine?
The InChIKey is NMLSNHBZNGFFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-8(2)6-9(3)7-10(11)4-5-10/h8-9H,4-7,11H2,1-3H3.
What are the key properties of 1-(2,4-dimethylpentyl)cyclopropan-1-amine?
1-(2,4-dimethylpentyl)cyclopropan-1-amine has a molecular weight of 155.28 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylpentyl)cyclopropan-1-amine is sourced from PubChem (CID 83682066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).