C11H19N — CID 83682461
4-cyclohexyl-1,2,3,6-tetrahydropyridine (PubChem CID 83682461) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 4-cyclohexyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-cyclohexyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 83682461 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4-cyclohexyl-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(C2CCCCC2)CCNC1 |
| InChI | InChI=1S/C11H19N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h6,10,12H,1-5,7-9H2 |
| InChIKey | GNSLCMVHAGOVGB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|