5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid

C5H4ClNO2S — CID 83683304

IUPAC5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid
SMILESCc1nc(C(=O)O)c(Cl)s1
InChIInChI=1S/C5H4ClNO2S/c1-2-7-3(5(8)9)4(6)10-2/h1H3,(H,8,9)
InChIKeyARJIDSQZRVTMJE-UHFFFAOYSA-N
MW177.61 g/mol
LogP1.80
Rot. Bonds1

About 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid

5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid (PubChem CID 83683304) has the molecular formula C5H4ClNO2S and a molecular weight of 177.61 g/mol. Its IUPAC name is 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid
PubChem CID83683304
Molecular FormulaC5H4ClNO2S
Molecular Weight177.61 g/mol
Exact Mass176.97
IUPAC Name5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid
SMILESCc1nc(C(=O)O)c(Cl)s1
InChIInChI=1S/C5H4ClNO2S/c1-2-7-3(5(8)9)4(6)10-2/h1H3,(H,8,9)
InChIKeyARJIDSQZRVTMJE-UHFFFAOYSA-N
XLogP1.80
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.61
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid (CID 83683304) is 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid is Cc1nc(C(=O)O)c(Cl)s1.
What is the InChIKey of 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is ARJIDSQZRVTMJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO2S/c1-2-7-3(5(8)9)4(6)10-2/h1H3,(H,8,9).
What are the key properties of 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid?
5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 177.61 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 83683304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).