2-(1-morpholin-4-ylcyclopropyl)acetic acid

C9H15NO3 — CID 83684257

IUPAC2-(1-morpholin-4-ylcyclopropyl)acetic acid
SMILESO=C(O)CC1(N2CCOCC2)CC1
InChIInChI=1S/C9H15NO3/c11-8(12)7-9(1-2-9)10-3-5-13-6-4-10/h1-7H2,(H,11,12)
InChIKeyCILBNWTXJPDZSR-UHFFFAOYSA-N
MW185.22 g/mol
LogP0.33
Rot. Bonds3

About 2-(1-morpholin-4-ylcyclopropyl)acetic acid

2-(1-morpholin-4-ylcyclopropyl)acetic acid (PubChem CID 83684257) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-(1-morpholin-4-ylcyclopropyl)acetic acid.

Molecular Properties

Compound Name2-(1-morpholin-4-ylcyclopropyl)acetic acid
PubChem CID83684257
Molecular FormulaC9H15NO3
Molecular Weight185.22 g/mol
Exact Mass185.11
IUPAC Name2-(1-morpholin-4-ylcyclopropyl)acetic acid
SMILESO=C(O)CC1(N2CCOCC2)CC1
InChIInChI=1S/C9H15NO3/c11-8(12)7-9(1-2-9)10-3-5-13-6-4-10/h1-7H2,(H,11,12)
InChIKeyCILBNWTXJPDZSR-UHFFFAOYSA-N
XLogP0.33
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.22
LogP ≤ 50.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1-morpholin-4-ylcyclopropyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-morpholin-4-ylcyclopropyl)acetic acid?
The IUPAC name of 2-(1-morpholin-4-ylcyclopropyl)acetic acid (CID 83684257) is 2-(1-morpholin-4-ylcyclopropyl)acetic acid.
What is the SMILES notation for 2-(1-morpholin-4-ylcyclopropyl)acetic acid?
The canonical SMILES for 2-(1-morpholin-4-ylcyclopropyl)acetic acid is O=C(O)CC1(N2CCOCC2)CC1.
What is the InChIKey of 2-(1-morpholin-4-ylcyclopropyl)acetic acid?
The InChIKey is CILBNWTXJPDZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c11-8(12)7-9(1-2-9)10-3-5-13-6-4-10/h1-7H2,(H,11,12).
What are the key properties of 2-(1-morpholin-4-ylcyclopropyl)acetic acid?
2-(1-morpholin-4-ylcyclopropyl)acetic acid has a molecular weight of 185.22 g/mol, XLogP of 0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-morpholin-4-ylcyclopropyl)acetic acid is sourced from PubChem (CID 83684257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).