About cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine
cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine (PubChem CID 83686035) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine |
| PubChem CID | 83686035 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine |
| SMILES | Cc1nc(C)c(C(N)C2CCC2)s1 |
| InChI | InChI=1S/C10H16N2S/c1-6-10(13-7(2)12-6)9(11)8-4-3-5-8/h8-9H,3-5,11H2,1-2H3 |
| InChIKey | GMXPRJOYXUGNAX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine?
The IUPAC name of cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine (CID 83686035) is cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine.
What is the SMILES notation for cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine?
The canonical SMILES for cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine is Cc1nc(C)c(C(N)C2CCC2)s1.
What is the InChIKey of cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine?
The InChIKey is GMXPRJOYXUGNAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-6-10(13-7(2)12-6)9(11)8-4-3-5-8/h8-9H,3-5,11H2,1-2H3.
What are the key properties of cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine?
cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine has a molecular weight of 196.32 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-(2,4-dimethyl-1,3-thiazol-5-yl)methanamine is sourced from PubChem (CID 83686035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).