About (5-ethyl-2-methylphenyl) 4-ethoxybenzoate
(5-ethyl-2-methylphenyl) 4-ethoxybenzoate (PubChem CID 836922) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is (5-ethyl-2-methylphenyl) 4-ethoxybenzoate.
Molecular Properties
| Compound Name | (5-ethyl-2-methylphenyl) 4-ethoxybenzoate |
| PubChem CID | 836922 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (5-ethyl-2-methylphenyl) 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2cc(CC)ccc2C)cc1 |
| InChI | InChI=1S/C18H20O3/c1-4-14-7-6-13(3)17(12-14)21-18(19)15-8-10-16(11-9-15)20-5-2/h6-12H,4-5H2,1-3H3 |
| InChIKey | MUKJIXUMYKYNSC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-2-methylphenyl) 4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2-methylphenyl) 4-ethoxybenzoate?
The IUPAC name of (5-ethyl-2-methylphenyl) 4-ethoxybenzoate (CID 836922) is (5-ethyl-2-methylphenyl) 4-ethoxybenzoate.
What is the SMILES notation for (5-ethyl-2-methylphenyl) 4-ethoxybenzoate?
The canonical SMILES for (5-ethyl-2-methylphenyl) 4-ethoxybenzoate is CCOc1ccc(C(=O)Oc2cc(CC)ccc2C)cc1.
What is the InChIKey of (5-ethyl-2-methylphenyl) 4-ethoxybenzoate?
The InChIKey is MUKJIXUMYKYNSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-4-14-7-6-13(3)17(12-14)21-18(19)15-8-10-16(11-9-15)20-5-2/h6-12H,4-5H2,1-3H3.
What are the key properties of (5-ethyl-2-methylphenyl) 4-ethoxybenzoate?
(5-ethyl-2-methylphenyl) 4-ethoxybenzoate has a molecular weight of 284.36 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2-methylphenyl) 4-ethoxybenzoate is sourced from PubChem (CID 836922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).