About 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid
3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid (PubChem CID 83693234) has the molecular formula C7H8BrNO2S
and a molecular weight of 250.12 g/mol. Its IUPAC name is 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid |
| PubChem CID | 83693234 |
| Molecular Formula | C7H8BrNO2S |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid |
| SMILES | CC(Cc1nc(Br)cs1)C(=O)O |
| InChI | InChI=1S/C7H8BrNO2S/c1-4(7(10)11)2-6-9-5(8)3-12-6/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | YCTFUXMECMAELS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid (CID 83693234) is 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid is CC(Cc1nc(Br)cs1)C(=O)O.
What is the InChIKey of 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid?
The InChIKey is YCTFUXMECMAELS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO2S/c1-4(7(10)11)2-6-9-5(8)3-12-6/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid?
3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid has a molecular weight of 250.12 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-1,3-thiazol-2-yl)-2-methylpropanoic acid is sourced from PubChem (CID 83693234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).