C16H27N3 — CID 83693634
3-(2-aminoethyl)-1-benzyl-N,N-dimethylpiperidin-3-amine (PubChem CID 83693634) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1-benzyl-N,N-dimethylpiperidin-3-amine.
| Compound Name | 3-(2-aminoethyl)-1-benzyl-N,N-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 83693634 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 3-(2-aminoethyl)-1-benzyl-N,N-dimethylpiperidin-3-amine |
| SMILES | CN(C)C1(CCN)CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H27N3/c1-18(2)16(10-11-17)9-6-12-19(14-16)13-15-7-4-3-5-8-15/h3-5,7-8H,6,9-14,17H2,1-2H3 |
| InChIKey | RDUKQXKFTZUMOX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |