About 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid
3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid (PubChem CID 83693703) has the molecular formula C8H10BrNO2S
and a molecular weight of 264.14 g/mol. Its IUPAC name is 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid |
| PubChem CID | 83693703 |
| Molecular Formula | C8H10BrNO2S |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1ncc(Br)s1)C(=O)O |
| InChI | InChI=1S/C8H10BrNO2S/c1-8(2,7(11)12)3-6-10-4-5(9)13-6/h4H,3H2,1-2H3,(H,11,12) |
| InChIKey | LUVQVAVWFMSEBR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid (CID 83693703) is 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid is CC(C)(Cc1ncc(Br)s1)C(=O)O.
What is the InChIKey of 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid?
The InChIKey is LUVQVAVWFMSEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNO2S/c1-8(2,7(11)12)3-6-10-4-5(9)13-6/h4H,3H2,1-2H3,(H,11,12).
What are the key properties of 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid?
3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid has a molecular weight of 264.14 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 83693703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).