C10H15BrN2S — CID 83694099
4-bromo-5-ethyl-2-(pyrrolidin-2-ylmethyl)-1,3-thiazole (PubChem CID 83694099) has the molecular formula C10H15BrN2S and a molecular weight of 275.21 g/mol. Its IUPAC name is 4-bromo-5-ethyl-2-(pyrrolidin-2-ylmethyl)-1,3-thiazole.
| Compound Name | 4-bromo-5-ethyl-2-(pyrrolidin-2-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 83694099 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 4-bromo-5-ethyl-2-(pyrrolidin-2-ylmethyl)-1,3-thiazole |
| SMILES | CCc1sc(CC2CCCN2)nc1Br |
| InChI | InChI=1S/C10H15BrN2S/c1-2-8-10(11)13-9(14-8)6-7-4-3-5-12-7/h7,12H,2-6H2,1H3 |
| InChIKey | CSBSOGMDIXIOGC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |